CAS 175153-33-0

Ethyl 4-imidazo[1,2-a]pyridin-2-ylbenzoate

Description:

Ethyl 4-imidazo[1,2-a]pyridin-2-ylbenzoate is a chemical compound characterized by its unique structure, which includes an imidazo[1,2-a]pyridine moiety and a benzoate group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the imidazole ring suggests that it may participate in hydrogen bonding and exhibit basicity, which can influence its reactivity and interactions with biological targets. Ethyl 4-imidazo[1,2-a]pyridin-2-ylbenzoate may also demonstrate pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, which can be explored for developing derivatives with enhanced activity or selectivity. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental conditions such as pH and temperature. Overall, this compound represents a class of substances that may have significant implications in drug discovery and development.

Formula: C₁₆H₁₄N₂O₂

InChI: InChI=1S/C16H14N2O2/c1-2-20-16(19)13-8-6-12(7-9-13)14-11-18-10-4-3-5-15(18)17-14/h3-11H,2H2,1H3

InChI key: InChIKey=BFJJNXCJBZHHFQ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC=C(C2=CN3C(=N2)C=CC=C3)C=C1

Synonyms:

• Ethyl 4-imidazo[1,2-a]pyridin-2-ylbenzoate
• Benzoic acid, 4-imidazo[1,2-a]pyridin-2-yl-, ethyl ester

Ethyl 4-imidazo[1,2-a]pyridin-2-ylbenzoate

CAS: 175153-33-0

Ethyl 4-imidazo[1,2-a]pyridin-2-ylbenzoate

Purity: ≥95%

Molecular weight: 266.29g/mol

Ref: 54-OR111165