CAS 175166-49-1: (-)-2,2'-Methylenebis[(3As,8Ar)-3A,8A-Dihydro-8H-Indeno[1,2-D]Oxazole]
Description:(-)-2,2'-Methylenebis[(3As,8Ar)-3A,8A-Dihydro-8H-Indeno[1,2-D]Oxazole], with the CAS number 175166-49-1, is a synthetic organic compound characterized by its complex bicyclic structure. This substance features a methylene bridge connecting two indeno[1,2-d]oxazole moieties, which contributes to its unique chemical properties. The compound exhibits chirality, indicated by the presence of specific stereocenters, which can influence its biological activity and interactions. Typically, compounds of this nature may exhibit interesting pharmacological properties, potentially acting as ligands or inhibitors in various biological pathways. The indeno[1,2-d]oxazole framework is known for its stability and ability to participate in various chemical reactions, making it a subject of interest in medicinal chemistry and material science. Additionally, the compound's solubility, melting point, and reactivity would depend on its specific functional groups and overall molecular conformation. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C21H18N2O2
InChI:InChI=1/C21H18N2O2/c1-3-7-14-12(5-1)9-16-20(14)22-18(24-16)11-19-23-21-15-8-4-2-6-13(15)10-17(21)25-19/h1-8,16-17,20-21H,9-11H2/t16-,17-,20+,21+/m1/s1
- Synonyms:
- [3aS-[2(3aR*,8aS*),3aalpha,8aalpha]]-()-2,2-Methylenebis[3a,8a-dihydro-8H-indeno[1,2-d]oxazole]
- 2,2'-methanediylbis(8,8a-dihydro-3aH-indeno[1,2-d][1,3]oxazole)
- (3aS,8aR,3a'S,8a'R)-2,2'-methanediylbis(8,8a-dihydro-3aH-indeno[1,2-d][1,3]oxazole)
- (-)-2,2'-Methylenebis[(3aS,8aR)-3a,8a-dihydro-8Hindeno[1,2-d]oxazole]