CymitQuimica logo

CAS 175201-50-0

:

4,5-Dichloro-1H-imidazole-1-ethanethioamide

Description:
4,5-Dichloro-1H-imidazole-1-ethanethioamide is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of two chlorine atoms at the 4 and 5 positions of the imidazole ring contributes to its reactivity and potential biological activity. The ethanethioamide functional group indicates that the compound contains a thioamide moiety, which can influence its chemical properties and interactions. This compound may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the chlorine substituents and the thioamide group. Safety and handling precautions are essential when working with this compound, as halogenated compounds can pose health risks. Overall, 4,5-Dichloro-1H-imidazole-1-ethanethioamide is a compound with potential applications in medicinal chemistry and agrochemicals.
Formula:C5H5Cl2N3S
InChI:InChI=1S/C5H5Cl2N3S/c6-4-5(7)10(2-9-4)1-3(8)11/h2H,1H2,(H2,8,11)
InChI key:InChIKey=LDYDMLUTTJALOR-UHFFFAOYSA-N
SMILES:C(C(N)=S)N1C(Cl)=C(Cl)N=C1
Synonyms:
  • (4,5-Dichloroimidazol-1-yl)thioacetamide
  • 1H-Imidazole-1-ethanethioamide, 4,5-dichloro-
  • 4,5-Dichloro-1H-imidazole-1-ethanethioamide
Found 3 products.