CAS 175201-51-1

4,7-Dimethylpyrazolo(1,5-a)pyrimidine-3-carboxylic acid

Description:

4,7-Dimethylpyrazolo(1,5-a)pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two methyl groups at the 4 and 7 positions of the pyrazole ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 3-position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. The compound is typically synthesized through multi-step organic reactions, and its structure can be confirmed using techniques such as NMR and mass spectrometry. Due to its structural features, it may exhibit biological activity, potentially serving as a scaffold for drug development. Additionally, its solubility and stability in different solvents can vary, influencing its practical applications in research and industry. Overall, 4,7-Dimethylpyrazolo(1,5-a)pyrimidine-3-carboxylic acid represents an interesting compound for further exploration in both synthetic and pharmaceutical chemistry.

Formula: C₉H₉N₃O₂

InChI: InChI=1/C9H9N3O2/c1-5-3-8-10-4-7(9(13)14)6(2)12(8)11-5/h3-4H,1-2H3,(H,13,14)

SMILES: Cc1cc2ncc(c(C)n2n1)C(=O)O

Synonyms:

• Dimethylpyrazoloapyrimidinecarboxylicacid
• 2,7-Dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid

2,7-Dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid

CAS: 175201-51-1

Formula: C₉H₉N₃O₂

Color and Shape: Solid

Molecular weight: 191.1867

Ref: IN-DA0020EF

2,7-Dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid

CAS: 175201-51-1

2,7-Dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid

Purity: 95%

Molecular weight: 191.19g/mol

Ref: 54-OR4078

2,7-Dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid

CAS: 175201-51-1

Versatile small molecule scaffold

Formula: C₉H₉N₃O₂

Purity: Min. 95%

Molecular weight: 191.19 g/mol

Ref: 3D-AHA20151