CAS 175201-85-1

5-[(1,1-Dimethylethyl)sulfonyl]-2-methyl-4-pyrimidinamine

Description:

5-[(1,1-Dimethylethyl)sulfonyl]-2-methyl-4-pyrimidinamine, with the CAS number 175201-85-1, is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a sulfonyl group, specifically a tert-butylsulfonyl moiety, contributes to its chemical reactivity and solubility properties. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit specific physical properties such as melting point, boiling point, and solubility, which are influenced by its functional groups. Additionally, it may undergo various chemical reactions, including nucleophilic substitutions and electrophilic additions, depending on the conditions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₅N₃O₂S

InChI: InChI=1S/C9H15N3O2S/c1-6-11-5-7(8(10)12-6)15(13,14)9(2,3)4/h5H,1-4H3,(H2,10,11,12)

InChI key: InChIKey=IPPJAHFTVBSZBA-UHFFFAOYSA-N

SMILES: S(C(C)(C)C)(=O)(=O)C=1C(N)=NC(C)=NC1

Synonyms:

• 4-Pyrimidinamine, 5-[(1,1-dimethylethyl)sulfonyl]-2-methyl-
• 5-[(1,1-Dimethylethyl)sulfonyl]-2-methyl-4-pyrimidinamine

4-Pyrimidinamine, 5-[(1,1-dimethylethyl)sulfonyl]-2-methyl-

CAS: 175201-85-1

Formula: C₉H₁₅N₃O₂S

Molecular weight: 229.2993

Ref: IN-DA0020EW

5-(tert-butylsulphonyl)-2-methylpyrimidin-4-amine

CAS: 175201-85-1

5-(tert-butylsulphonyl)-2-methylpyrimidin-4-amine

Purity: ≥95%

Molecular weight: 229.30g/mol

Ref: 54-OR25182