
CAS 175201-89-5
:3-amino-4-(isopropylsulfonyl)thiophene-2-carboxylic acid
Description:
3-Amino-4-(isopropylsulfonyl)thiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of the isopropylsulfonyl group enhances its solubility and reactivity, making it suitable for various chemical reactions and applications in medicinal chemistry. The thiophene structure provides stability and contributes to the compound's electronic properties, which can influence its interaction with biological targets. Additionally, the compound may exhibit specific pharmacological activities, making it of interest in drug development. Its CAS number, 175201-89-5, allows for easy identification and reference in chemical databases. Overall, this compound's unique functional groups and structural features position it as a valuable candidate for further research in synthetic and medicinal chemistry.
Formula:C8H11NO4S2
InChI:InChI=1/C8H11NO4S2/c1-4(2)15(12,13)5-3-14-7(6(5)9)8(10)11/h3-4H,9H2,1-2H3,(H,10,11)
SMILES:CC(C)S(=O)(=O)c1csc(c1N)C(=O)O
Synonyms:- 3-Amino-4-[(1-Methylethyl)Sulfonyl]Thiophene-2-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-amino-4-(isopropylsulfonyl)thiophene-2-carboxylic acid
CAS:Formula:C8H11NO4S2Molecular weight:249.30723-amino-4-(isopropylsulphonyl)thiophene-2-carboxylic acid
CAS:3-amino-4-(isopropylsulphonyl)thiophene-2-carboxylic acidFormula:C8H11NO4S2Purity:techColor and Shape: light brown powderMolecular weight:249.31g/mol

