CAS 175202-20-7

Ethyl 2-[(4,5-dichloro-1H-imidazol-1-yl)methyl]-4-thiazolecarboxylate

Description:

Ethyl 2-[(4,5-dichloro-1H-imidazol-1-yl)methyl]-4-thiazolecarboxylate is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a thiazole ring, and a dichloro-substituted imidazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many thiazole derivatives. It may display biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of antimicrobial or antifungal agents. The presence of the dichloro substituents can influence its reactivity and interaction with biological targets. Additionally, the thiazole and imidazole rings contribute to its potential as a heterocyclic compound, which often plays a significant role in various chemical reactions and applications. Safety and handling precautions should be observed due to the presence of chlorine atoms, which can impart toxicity. Overall, this compound's unique structural features make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₉Cl₂N₃O₂S

InChI: InChI=1S/C10H9Cl2N3O2S/c1-2-17-10(16)6-4-18-7(14-6)3-15-5-13-8(11)9(15)12/h4-5H,2-3H2,1H3

InChI key: InChIKey=DNYYFIVLIFBMGF-UHFFFAOYSA-N

SMILES: C(N1C(Cl)=C(Cl)N=C1)C2=NC(C(OCC)=O)=CS2

Synonyms:

• Ethyl 2-[(4,5-dichloro-1H-imidazol-1-yl)methyl]-4-thiazolecarboxylate
• 4-Thiazolecarboxylic acid, 2-[(4,5-dichloro-1H-imidazol-1-yl)methyl]-, ethyl ester

4-Thiazolecarboxylic acid, 2-[(4,5-dichloro-1H-imidazol-1-yl)methyl]-, ethyl ester

CAS: 175202-20-7

Formula: C₁₀H₉Cl₂N₃O₂S

Molecular weight: 306.1684

Ref: IN-DA0020GQ

ethyl 2-[(4,5-dichloro-1H-imidazol-1-yl)methyl]-1,3-thiazole-4-carboxylate

CAS: 175202-20-7

ethyl 2-[(4,5-dichloro-1H-imidazol-1-yl)methyl]-1,3-thiazole-4-carboxylate

Purity: ≥95%

Ref: 54-OR25233