CAS 175202-60-5

3,4-Dimethylthieno[2,3-b]thiophene-2-methanol

Description:

3,4-Dimethylthieno[2,3-b]thiophene-2-methanol is an organic compound characterized by its unique structure, which includes a thieno[2,3-b]thiophene core with two methyl groups at the 3 and 4 positions and a hydroxymethyl group at the 2 position. This compound is part of a class of heterocyclic compounds that exhibit interesting electronic properties, making them potential candidates for applications in organic electronics, such as organic semiconductors and photovoltaic devices. The presence of the thieno ring system contributes to its conjugated structure, which can enhance its charge transport properties. Additionally, the hydroxymethyl group may influence its solubility and reactivity, potentially allowing for further functionalization. The compound's molecular weight, boiling point, and solubility characteristics would depend on its specific interactions with solvents and other materials. Overall, 3,4-Dimethylthieno[2,3-b]thiophene-2-methanol represents a versatile building block in organic synthesis and materials science.

Formula: C₉H₁₀OS₂

InChI: InChI=1S/C9H10OS2/c1-5-4-11-9-8(5)6(2)7(3-10)12-9/h4,10H,3H2,1-2H3

InChI key: InChIKey=VLNHLFCDQQFNBH-UHFFFAOYSA-N

SMILES: CC=1C2=C(SC1CO)SC=C2C

Synonyms:

• 3,4-Dimethylthieno[2,3-b]thiophene-2-methanol
• Thieno[2,3-b]thiophene-2-methanol, 3,4-dimethyl-
• [3,4-Dimethylthieno[2,3-b]thiophen-2-yl]methanol

Thieno[2,3-b]thiophene-2-methanol, 3,4-dimethyl-

CAS: 175202-60-5

Formula: C₉H₁₀OS₂

Molecular weight: 198.3051

Ref: IN-DA0020H2

(3,4-dimethylthieno[2,3-b]thiophen-2-yl)methanol

CAS: 175202-60-5

(3,4-dimethylthieno[2,3-b]thiophen-2-yl)methanol

Purity: ≥95%

Ref: 54-OR25296