CAS 175202-77-4
:6-(4-Methoxyphenyl)-2(1H)-pyrimidinethione
Description:
6-(4-Methoxyphenyl)-2(1H)-pyrimidinethione, with the CAS number 175202-77-4, is a chemical compound characterized by its pyrimidinethione core structure, which features a sulfur atom bonded to a carbon atom within a pyrimidine ring. The presence of the 4-methoxyphenyl group enhances its chemical properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, possibly acting as an inhibitor or modulator in various biochemical pathways. The methoxy group can also affect the compound's electronic properties, potentially enhancing its lipophilicity and bioavailability. As with many heterocyclic compounds, the stability and reactivity of 6-(4-Methoxyphenyl)-2(1H)-pyrimidinethione can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of organic molecules that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C11H10N2OS
InChI:InChI=1S/C11H10N2OS/c1-14-9-4-2-8(3-5-9)10-6-7-12-11(15)13-10/h2-7H,1H3,(H,12,13,15)
InChI key:InChIKey=KSXDNCUHISGCTF-UHFFFAOYSA-N
SMILES:S=C1NC(=CC=N1)C2=CC=C(OC)C=C2
Synonyms:- 2(1H)-Pyrimidinethione, 4-(4-methoxyphenyl)-
- 2(1H)-Pyrimidinethione, 6-(4-methoxyphenyl)-
- 6-(4-Methoxyphenyl)-2(1H)-pyrimidinethione
- 6-(4-methoxyphenyl)pyrimidine-2(1H)-thione
- 4-(4-Methoxyphenyl)pyrimidine-2-thiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2(1H)-Pyrimidinethione, 6-(4-methoxyphenyl)-
CAS:Formula:C11H10N2OSPurity:98%Color and Shape:SolidMolecular weight:218.27494-(4-Methoxyphenyl)pyrimidine-2-thiol
CAS:4-(4-Methoxyphenyl)pyrimidine-2-thiolPurity:95%Color and Shape:Yellow SolidMolecular weight:218.27g/mol4-(4-Methoxyphenyl)-2-pyrimidinethiol
CAS:4-(4-Methoxyphenyl)-2-pyrimidinethiol is a synthetic nucleoside analog. It is a monophosphate that inhibits the production of RNA by inhibiting ribonucleotide reductase. 4-(4-Methoxyphenyl)-2-pyrimidinethiol has antiviral properties and can be used to treat infections caused by herpes simplex virus or HIV. This compound also has anticancer activity and can inhibit DNA synthesis in tumor cells. 4-(4-Methoxyphenyl)-2-pyrimidinethiol can also inhibit bacterial growth and is used as an antibiotic for Mycobacterium tuberculosis, Mycobacterium avium, and other bacteria.Formula:C11H10N2OSPurity:Min. 95%Molecular weight:218.28 g/mol



