CAS 175203-38-0

7-Chloro-2-(1,1-dimethylethyl)-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

Description:

7-Chloro-2-(1,1-dimethylethyl)-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features a chlorine atom at the 7-position and a trifluoromethyl group at the 5-position, contributing to its unique chemical reactivity and potential biological activity. The presence of the bulky 1,1-dimethylethyl group at the 2-position enhances its lipophilicity, which may influence its pharmacokinetic properties. The trifluoromethyl group is known to increase metabolic stability and can enhance the compound's interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit activity against specific biological pathways or targets. Its molecular structure suggests it could participate in various chemical reactions, making it a valuable compound for further research in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₁₁ClF₃N₃

InChI: InChI=1S/C11H11ClF3N3/c1-10(2,3)6-5-9-16-7(11(13,14)15)4-8(12)18(9)17-6/h4-5H,1-3H3

InChI key: InChIKey=VYAQQNNHHQAUEL-UHFFFAOYSA-N

SMILES: ClC=1N2C(=CC(C(C)(C)C)=N2)N=C(C(F)(F)F)C1

Synonyms:

• 7-Chloro-2-(1,1-dimethylethyl)-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine
• Butylchlorotrifluoromethylpyrazolopyrimidine
• Methyl 4-Hydroxy-2-(Trifluoromethyl)Thieno[3,4-B]Pyridine-7-Carboxylate
• Pyrazolo[1,5-a]pyrimidine, 7-chloro-2-(1,1-dimethylethyl)-5-(trifluoromethyl)-

2-tert-Butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

CAS: 175203-38-0

2-tert-Butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

Purity: 97%

Molecular weight: 277.67g/mol

Ref: 54-PC1604