CymitQuimica logo

CAS 175203-45-9

:

methyl 5-chlorosulfonyl-4-methoxythiophene-3-carboxylate

Description:
Methyl 5-chlorosulfonyl-4-methoxythiophene-3-carboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring, a methoxy group, and a chlorosulfonyl moiety. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, reflecting its polar functional groups. The presence of the chlorosulfonyl group suggests that it may participate in electrophilic substitution reactions, making it a potential candidate for various synthetic applications in organic chemistry. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. Methyl 5-chlorosulfonyl-4-methoxythiophene-3-carboxylate may also exhibit biological activity, which could be of interest in pharmaceutical research. Its specific applications and reactivity would depend on the context of its use, including potential roles in drug development or as an intermediate in organic synthesis. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H7ClO5S2
InChI:InChI=1/C7H7ClO5S2/c1-12-5-4(6(9)13-2)3-14-7(5)15(8,10)11/h3H,1-2H3
InChI key:IJGCJDNTXHGTFB-UHFFFAOYSA-N
SMILES:COc1c(csc1S(=O)(=O)Cl)C(=O)OC
Synonyms:
  • Methyl-5-chlorosulphonyl-4-methoxythiophene-3-carboxylate
Found 3 products.