CAS 175203-46-0

3-(METHYLTHIO)-1-PHENYL-1H-PYRAZOLE-4-CARBONITRILE

Description:

3-(Methylthio)-1-phenyl-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a methylthio group indicates a sulfur atom bonded to a methyl group, contributing to the compound's unique properties. The phenyl group attached to the pyrazole ring enhances its aromatic character, while the carbonitrile functional group (-C≡N) introduces a polar and reactive site, making the compound potentially useful in various chemical reactions and applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, which could lead to pharmacological effects. Additionally, the compound's stability and solubility characteristics would depend on the specific conditions and solvents used. Overall, 3-(methylthio)-1-phenyl-1H-pyrazole-4-carbonitrile represents a versatile scaffold for further chemical modifications and investigations in both synthetic and medicinal chemistry.

Formula: C₁₁H₉N₃S

InChI: InChI=1/C11H9N3S/c1-15-11-9(7-12)8-14(13-11)10-5-3-2-4-6-10/h2-6,8H,1H3

SMILES: CSc1c(C#N)cn(c2ccccc2)n1

Synonyms:

• 3-(Methylthio)-1H-pyrazole-4-carbonitrile
• 4-Cyano-3-(Methylthio)-1-Phenylpyrazole
• 3-(methylsulfanyl)-1-phenyl-1H-pyrazole-4-carbonitrile

3-(Methylthio)-1-phenyl-1H-pyrazole-4-carbonitrile

CAS: 175203-46-0

Formula: C₁₁H₉N₃S

Molecular weight: 215.2743

Ref: IN-DA0020J8

3-(Methylthio)-1-phenyl-1H-pyrazole-4-carbonitrile

CAS: 175203-46-0

3-(Methylthio)-1-phenyl-1H-pyrazole-4-carbonitrile

Purity: ≥95%

Molecular weight: 215.27g/mol

Ref: 54-OR25578