CAS 175203-49-3

3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbothioamide

Description:

3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbothioamide is a synthetic organic compound characterized by its complex structure, which includes a tetrahydropyrimidine ring, a benzyl group, and a carbothioamide functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, including antimicrobial or anticancer effects, due to its unique molecular framework. The presence of the dioxo groups suggests it may participate in various chemical reactions, including nucleophilic attacks or coordination with metal ions. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in pharmaceuticals or as a research chemical. Additionally, the compound's specific interactions with biological targets can be influenced by its stereochemistry and functional groups, making it a subject of interest in medicinal chemistry and drug design. Overall, 3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbothioamide represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₁₅H₁₇N₃O₂S

InChI: InChI=1/C15H17N3O2S/c1-10(2)17-9-12(13(16)21)14(19)18(15(17)20)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H2,16,21)

SMILES: CC(C)n1cc(C(=N)S)c(=O)n(Cc2ccccc2)c1=O

Synonyms:

• 3-Benzyl-1-(1-Methylethyl)-2,4-Dioxo-1,2,3,4-Tetrahydropyrimidine-5-Carbothioamide

5-Pyrimidinecarbothioamide, 1,2,3,4-tetrahydro-1-(1-methylethyl)-2,4-dioxo-3-(phenylmethyl)-

CAS: 175203-49-3

Formula: C₁₅H₁₇N₃O₂S

Molecular weight: 303.3794

Ref: IN-DA0020J5

3-Benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbothioamide

CAS: 175203-49-3

3-Benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbothioamide

Purity: ≥95%

Molecular weight: 303.38g/mol

Ref: 54-OR25584