CymitQuimica logo

CAS 175204-04-3

:

2-ETHOXY-6-(2,2,2-TRIFLUOROETHOXY)BENZONITRILE

Description:
2-Ethoxy-6-(2,2,2-trifluoroethoxy)benzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an ethoxy group and a trifluoroethoxy group, as well as a nitrile functional group. The presence of the ethoxy and trifluoroethoxy substituents contributes to its unique chemical properties, such as increased lipophilicity and potential for specific interactions in biological systems. The trifluoroethoxy group, in particular, enhances the compound's stability and may influence its reactivity and solubility in various solvents. This compound is likely to exhibit moderate to high polarity due to the nitrile and ether functionalities, which can affect its behavior in chemical reactions and applications. Additionally, the presence of fluorine atoms typically imparts unique electronic properties, potentially making it useful in medicinal chemistry or materials science. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C11H10F3NO2
InChI:InChI=1/C11H10F3NO2/c1-2-16-9-4-3-5-10(8(9)6-15)17-7-11(12,13)14/h3-5H,2,7H2,1H3
InChI key:InChIKey=YZBRNALJPGILPM-UHFFFAOYSA-N
SMILES:C(#N)C1=C(OCC(F)(F)F)C=CC=C1OCC
Synonyms:
  • 2-Ethoxy-6-(2,2,2-trifluoroethoxy)benzonitrile, tech
  • Benzonitrile, 2-ethoxy-6-(2,2,2-trifluoroethoxy)-
  • 2-Ethoxy-6-(2,2,2-trifluoroethoxy)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.