CAS 175204-06-5
:2-Fluoro-6-phenoxybenzonitrile
Description:
2-Fluoro-6-phenoxybenzonitrile is an organic compound characterized by its unique molecular structure, which includes a fluorine atom, a phenoxy group, and a benzonitrile moiety. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of multiple benzene rings. The fluorine substituent can influence the compound's reactivity and polarity, potentially enhancing its solubility in organic solvents. The phenoxy group contributes to the compound's overall stability and may affect its interactions in biological systems. As a benzonitrile derivative, it may also exhibit properties relevant to pharmaceuticals or agrochemicals, making it of interest in various chemical research fields. Additionally, the compound's structure suggests potential applications in materials science or as a building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H8FNO
InChI:InChI=1/C13H8FNO/c14-12-7-4-8-13(11(12)9-15)16-10-5-2-1-3-6-10/h1-8H
SMILES:c1ccc(cc1)Oc1cccc(c1C#N)F
Synonyms:- 2-Fluoro-6-phenyloxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzonitrile, 2-fluoro-6-phenoxy-
CAS:Formula:C13H8FNOPurity:95%Color and Shape:SolidMolecular weight:213.20712-Fluoro-6-phenoxybenzonitrile
CAS:2-Fluoro-6-phenoxybenzonitrilePurity:95%Color and Shape:White PowderMolecular weight:213.21g/mol2-Fluoro-6-phenoxybenzonitrile
CAS:2-Fluoro-6-phenoxybenzonitrile is activated by calcium oxide to form a reactive intermediate that participates in the polymerization reaction. It is also used as a building block for the synthesis of other compounds. 2-Fluoro-6-phenoxybenzonitrile can be used as a crosslinker and toughening agent in polymers, and has been shown to have nucleophilic properties. The mechanisms of its activation by calcium oxide are not yet fully understood, but it is known that this process produces reactive intermediates that are capable of forming ester bonds with other molecules.Formula:C13H8FNOPurity:Min. 95%Color and Shape:PowderMolecular weight:213.21 g/mol2-Fluoro-6-phenoxybenzonitrile
CAS:Formula:C13H8FNOPurity:95%Color and Shape:SolidMolecular weight:213.211



