CymitQuimica logo

CAS 175204-09-8

:

2-FLUORO-6-(4-METHYLBENZYLOXY)BENZONITRILE

Description:
2-Fluoro-6-(4-methylbenzyloxy)benzonitrile is an organic compound characterized by its complex aromatic structure, which includes a fluorine atom and a nitrile functional group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. The 4-methylbenzyloxy group contributes to the compound's overall hydrophobic character and can affect its solubility in various solvents. This compound is likely to exhibit properties typical of nitriles, such as being polar and having a high boiling point relative to non-polar compounds. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can be significant in biological systems or material applications. As with many organic compounds, its reactivity may be influenced by the electron-withdrawing nature of the nitrile and the electron-donating characteristics of the alkoxy group. Overall, 2-fluoro-6-(4-methylbenzyloxy)benzonitrile is of interest in fields such as medicinal chemistry and materials science, where its unique structural features may be exploited for specific applications.
Formula:C15H12FNO
InChI:InChI=1/C15H12FNO/c1-11-5-7-12(8-6-11)10-18-15-4-2-3-14(16)13(15)9-17/h2-8H,10H2,1H3
InChI key:PYDSAKVFHVQAAD-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)COc1cccc(c1C#N)F
Found 3 products.