CAS 175204-33-8
:N2-(2,6-Diethylphenyl)-1,3,5-triazine-2,4-diamine
Description:
N2-(2,6-Diethylphenyl)-1,3,5-triazine-2,4-diamine, with the CAS number 175204-33-8, is a chemical compound characterized by its triazine core structure, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features two ethyl groups attached to a phenyl ring, contributing to its hydrophobic properties and potentially influencing its solubility in organic solvents. The presence of amino groups at the 2 and 4 positions of the triazine ring enhances its reactivity, making it suitable for various applications, including as a potential intermediate in organic synthesis or in the development of dyes and pigments. The compound's molecular structure suggests it may exhibit interesting electronic properties, which could be leveraged in materials science or pharmaceuticals. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a unique class of triazine derivatives with potential utility in various chemical fields.
Formula:C13H17N5
InChI:InChI=1S/C13H17N5/c1-3-9-6-5-7-10(4-2)11(9)17-13-16-8-15-12(14)18-13/h5-8H,3-4H2,1-2H3,(H3,14,15,16,17,18)
InChI key:InChIKey=UXZJVCHQOULLDR-UHFFFAOYSA-N
SMILES:N(C1=C(CC)C=CC=C1CC)C=2N=C(N)N=CN2
Synonyms:- N2-(2,6-Diethylphenyl)-1,3,5-triazine-2,4-diamine
- 1,3,5-Triazine-2,4-diamine, N-(2,6-diethylphenyl)-
- 1,3,5-Triazine-2,4-diamine, N2-(2,6-diethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
