CAS 175204-59-8

2,6-dichloropyridine-4-carboximidamide hydrochloride

Description:

2,6-Dichloropyridine-4-carboximidamide hydrochloride is a chemical compound characterized by its pyridine ring structure, which features two chlorine substituents at the 2 and 6 positions and a carboximidamide functional group at the 4 position. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in research and development. It is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activity. The presence of the dichloro substituents may influence its reactivity and interaction with biological targets. As with many nitrogen-containing heterocycles, it may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on the context of its use. Safety data should be consulted, as handling of this compound requires appropriate precautions due to its potential toxicity and the presence of chlorine atoms, which can pose environmental and health risks.

Formula: C₆H₆Cl₃N₃

InChI: InChI=1/C6H5Cl2N3.ClH/c7-4-1-3(6(9)10)2-5(8)11-4;/h1-2H,(H3,9,10);1H

SMILES: c1c(cc(Cl)nc1Cl)C(=N)N.Cl

2,6-dichloropyridine-4-carboximidamide hydrochloride

CAS: 175204-59-8

2,6-dichloropyridine-4-carboximidamide hydrochloride

Purity: ≥95%

Molecular weight: 226.49g/mol

Ref: 54-OR27310