CAS 175205-51-3

1-[3,5-Bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole

Description:

1-[3,5-Bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole is a synthetic organic compound characterized by its unique molecular structure, which includes a pyrrole ring substituted with both a dimethyl group and a phenyl group that carries two trifluoromethyl groups. This compound is notable for its potential applications in materials science and medicinal chemistry due to the presence of the trifluoromethyl groups, which can enhance lipophilicity and influence biological activity. The trifluoromethyl groups are known for their electron-withdrawing properties, which can affect the reactivity and stability of the compound. Additionally, the dimethyl substitution on the pyrrole ring can impact its electronic properties and steric hindrance. The compound's physical properties, such as solubility and melting point, can vary based on its molecular interactions and the presence of functional groups. Overall, 1-[3,5-Bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole represents a class of compounds that are of interest for further research and development in various chemical applications.

Formula: C₁₄H₁₁F₆N

InChI: InChI=1/C14H11F6N/c1-8-3-4-9(2)21(8)12-6-10(13(15,16)17)5-11(7-12)14(18,19)20/h3-7H,1-2H3

SMILES: Cc1ccc(C)n1c1cc(cc(c1)C(F)(F)F)C(F)(F)F

Synonyms:

• 1-[3,5-Bis(trifluoromethyl)phenyl]-2,5-dimethyl-1H-pyrrole
• Bistrifluoromethylphenyldimethylpyrrole

1H-Pyrrole, 1-[3,5-bis(trifluoromethyl)phenyl]-2,5-dimethyl-

CAS: 175205-51-3

Formula: C₁₄H₁₁F₆N

Purity: 97%

Color and Shape: Liquid

Molecular weight: 307.2343

Ref: IN-DA0020P4

1-[3,5-Bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole

CAS: 175205-51-3

1-[3,5-Bis(trifluoromethyl)phenyl]-2,5-dimethylpyrrole

Purity: 97%

Molecular weight: 307.23g/mol

Ref: 54-PC9021