CAS 175205-55-7

1-Bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene

Description:

1-Bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is an organohalogen compound characterized by the presence of multiple halogen substituents on a benzene ring. This compound features a bromine atom, a chlorine atom, and an iodine atom, along with a trifluoromethyl group (-CF3) attached to the aromatic system. The presence of these halogens significantly influences its chemical properties, including reactivity and polarity. The trifluoromethyl group is known for imparting unique electronic properties, making the compound potentially useful in various applications, such as in pharmaceuticals and agrochemicals. The compound's structure suggests it may exhibit interesting interactions in nucleophilic substitution reactions due to the electron-withdrawing effects of the halogens. Additionally, the presence of multiple halogens can enhance its stability and alter its solubility in different solvents. Overall, 1-Bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene is a complex molecule with diverse potential applications in synthetic chemistry and material science.

Formula: C₇H₂BrClF₃I

InChI: InChI=1S/C7H2BrClF3I/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H

InChI key: InChIKey=RDWKEGGZLPOJAE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(Br)=C(I)C(Cl)=C1

Synonyms:

• Benzene, 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)-
• 1-Bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene

Benzene, 1-bromo-3-chloro-2-iodo-5-(trifluoromethyl)-

CAS: 175205-55-7

Formula: C₇H₂BrClF₃I

Purity: 96%

Color and Shape: Liquid

Molecular weight: 385.3475

Ref: IN-DA0020P0

3-Bromo-5-chloro-4-iodobenzotrifluoride

CAS: 175205-55-7

3-Bromo-5-chloro-4-iodobenzotrifluoride

Formula: C₇H₂BrClF₃I

Purity: 97%

Color and Shape: light yellow/green crystalline solid

Molecular weight: 385.35g/mol

Ref: 54-PC1368G

1-Bromo-3-chloro-2-iodo-5-(trifluoromethyl)benzene

CAS: 175205-55-7

Purity: ≥95%

Molecular weight: 385.3500061

Ref: 10-F629269