CAS 175205-68-2: 2-(1-Methylhydrazinyl)-3-(trifluoromethyl)pyridine
Description:2-(1-Methylhydrazinyl)-3-(trifluoromethyl)pyridine, with the CAS number 175205-68-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with both a methylhydrazinyl group and a trifluoromethyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The methylhydrazinyl moiety introduces potential for hydrogen bonding and reactivity, particularly in the context of nucleophilic reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including agrochemicals and materials science. Additionally, the presence of fluorine atoms typically imparts unique electronic properties, which can affect the compound's stability and interaction with biological targets. As with many nitrogen-containing heterocycles, it is essential to consider safety and handling protocols due to potential toxicity associated with hydrazine derivatives.
Formula:C7H8F3N3
InChI:InChI=1S/C7H8F3N3/c1-13(11)6-5(7(8,9)10)3-2-4-12-6/h2-4H,11H2,1H3
InChI key:InChIKey=DCWFZFNVIDBWHB-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CC=CN=C1N(N)C
- Synonyms:
- 1-Methyl-1-[3-(trifluoromethyl)-2-pyridyl]hydrazine
- 1-Methyl-1-[3-(trifluoromethyl)pyridin-2-yl]hydrazine
- 2-(1-Methylhydrazinyl)-3-(trifluoromethyl)pyridine
- Pyridine, 2-(1-methylhydrazino)-3-(trifluoromethyl)-
- Pyridine, 2-(1-methylhydrazinyl)-3-(trifluoromethyl)-
- Trifluoromethylpyridylmethylhydrazine1

Pyridine, 2-(1-methylhydrazinyl)-3-(trifluoromethyl)-
Ref: IN-DA0020OO
Undefined size | To inquire |

2-(N-Methylhydrazino)-3-(trifluoromethyl)pyridine
Ref: 54-PC7221
250mg | 32.00 € | ||
500mg | 36.00 € |

N-[3-(Trifluoromethyl)pyrid-2-yl]-N-methyl-hydrazine
Ref: 10-F008454
1g | To inquire | ||
5g | To inquire |

2-(1-Methylhydrazinyl)-3-(Trifluoromethyl)-Pyridine
Ref: 3D-FM92638
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |