CAS 175205-85-3
:3,5-dibromobenzamide
Description:
3,5-Dibromobenzamide is an organic compound characterized by the presence of a benzene ring substituted with two bromine atoms at the 3 and 5 positions, along with an amide functional group (-C(=O)NH2) attached to the benzene. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the bromine substituents, which can participate in various chemical reactions. The presence of the amide group contributes to its solubility in polar solvents and influences its biological activity. Additionally, 3,5-dibromobenzamide may exhibit specific properties such as melting and boiling points that are influenced by its molecular structure and intermolecular interactions. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 3,5-dibromobenzamide is a compound of interest in synthetic organic chemistry and material science.
Formula:C7H5Br2NO
InChI:InChI=1/C7H5Br2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11)
SMILES:c1c(cc(cc1Br)Br)C(=N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzamide, 3,5-dibromo-
CAS:Formula:C7H5Br2NOPurity:95%Color and Shape:SolidMolecular weight:278.92873,5-Dibromobenzamide
CAS:3,5-DibromobenzamideFormula:C7H5Br2NOPurity:97%Color and Shape: off-white crystalline powderMolecular weight:278.93g/mol3,5-Dibromobenzamide
CAS:3,5-Dibromobenzamide is a chemical compound that is used for the synthesis of organic compounds. It can be used to make acetylenes by reacting with alkenes. 3,5-Dibromobenzamide has been shown to be an efficient cross-coupling agent in the reaction of arylboronic acids and methylene compounds. This product is also a powerful photolysis agent, which is used in the production of photophysical devices such as lasers and LEDs. 3,5-Dibromobenzamide has yellowish crystals that are soluble in water and decompose at high temperatures.
Formula:C7H5Br2NOPurity:Min. 95%Color and Shape:PowderMolecular weight:278.93 g/mol



