
CAS 17526-17-9
:Ibericin
Description:
Ibericin, with the CAS number 17526-17-9, is a naturally occurring compound classified as a flavonoid. It is primarily derived from various plant sources, particularly those in the genus Iberis, which is known for its medicinal properties. Ibericin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and antimicrobial effects, making it of interest in pharmacological research. The compound's structure features a flavone backbone, which is characteristic of many flavonoids, contributing to its potential health benefits. Additionally, Ibericin has been studied for its role in modulating various biochemical pathways, which may have implications for therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its bioavailability and efficacy in biological systems. Overall, Ibericin represents a significant area of study within natural product chemistry and its potential uses in medicine and health.
Formula:C17H14O5
InChI:InChI=1S/C17H14O5/c1-2-22-8-12-13(18)7-11-14(17(12)21)16(20)10-6-4-3-5-9(10)15(11)19/h3-7,18,21H,2,8H2,1H3
InChI key:InChIKey=VRARPPQMEQUQET-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC(O)=C(COCC)C2O
Synonyms:- 9,10-Anthracenedione, 2-(ethoxymethyl)-1,3-dihydroxy-
- Anthraquinone, 2-(ethoxymethyl)-1,3-dihydroxy-
- Ibericin
- 2-(Ethoxymethyl)-1,3-dihydroxy-9,10-anthracenedione
- 1,3-Dihydroxy-2-ethoxymethylanthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lucidin ethyl ether
CAS:Ibericin, an anthraquinone from Prismatomeris filamentosa roots, exhibits antibacterial effects on Gram-positive and Gram-negative bacteria.Formula:C17H14O5Color and Shape:SolidMolecular weight:298.29
