CymitQuimica logo

CAS 175276-49-0

:

methyl 4-formyl-1,2,5-trimethyl-1H-pyrrole-3-carboxylate

Description:
Methyl 4-formyl-1,2,5-trimethyl-1H-pyrrole-3-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a formyl group (-CHO) and a carboxylate group (-COOCH3) attached to the pyrrole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of three methyl groups enhances its hydrophobicity and may influence its solubility in various organic solvents. This compound is likely to exhibit interesting chemical properties, such as the ability to participate in electrophilic aromatic substitution reactions due to the electron-donating nature of the methyl groups. Additionally, the formyl group can serve as a reactive site for further functionalization, making it valuable in the synthesis of more complex molecules. Its specific applications may include use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity and reactivity.
Formula:C10H13NO3
InChI:InChI=1/C10H13NO3/c1-6-8(5-12)9(10(13)14-4)7(2)11(6)3/h5H,1-4H3
SMILES:Cc1c(C=O)c(c(C)n1C)C(=O)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.