CymitQuimica logo

CAS 175276-59-2

:

Ethyl 5-(4-chlorophenyl)-2-(trifluoromethyl)-3-furoate

Description:
Ethyl 5-(4-chlorophenyl)-2-(trifluoromethyl)-3-furoate is an organic compound characterized by its furoate structure, which includes a furan ring fused with an ester functional group. The presence of a trifluoromethyl group and a para-chlorophenyl substituent contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, particularly in the synthesis of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances its stability and reactivity, while the chlorophenyl moiety may impart specific interactions with biological targets. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, Ethyl 5-(4-chlorophenyl)-2-(trifluoromethyl)-3-furoate is a compound of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C14H10ClF3O3
InChI:InChI=1S/C14H10ClF3O3/c1-2-20-13(19)10-7-11(21-12(10)14(16,17)18)8-3-5-9(15)6-4-8/h3-7H,2H2,1H3
InChI key:MCLQZAOFPDFYKV-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(OC(=C1)C2=CC=C(C=C2)Cl)C(F)(F)F
Found 2 products.