CAS 175276-65-0

3-[5-(tert-butyl)-2-methyl-3-furyl]-3-oxopropanenitrile

Description:

3-[5-(tert-butyl)-2-methyl-3-furyl]-3-oxopropanenitrile, with the CAS number 175276-65-0, is an organic compound characterized by its unique structural features. It contains a furan ring, which is a five-membered aromatic ring with oxygen, contributing to its reactivity and potential biological activity. The presence of a tert-butyl group enhances its hydrophobic properties, while the nitrile functional group (-C≡N) indicates a high degree of polarity and potential for nucleophilic reactions. The compound also features a ketone group (3-oxopropanenitrile), which can participate in various chemical transformations, making it a versatile intermediate in organic synthesis. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the furan moiety, which is often associated with bioactive compounds. Overall, this compound's characteristics, including its functional groups and structural complexity, make it of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1/C12H15NO2/c1-8-9(10(14)5-6-13)7-11(15-8)12(2,3)4/h7H,5H2,1-4H3

SMILES: Cc1c(cc(C(C)(C)C)o1)C(=O)CC#N

Synonyms:

• 3-(5-Tert-Butyl-2-Methylfuran-3-Yl)-3-Oxopropanenitrile

3-[5-(tert-butyl)-2-methyl-3-furyl]-3-oxopropanenitrile

CAS: 175276-65-0

3-[5-(tert-butyl)-2-methyl-3-furyl]-3-oxopropanenitrile

Purity: ≥95%

Molecular weight: 205.25g/mol

Ref: 54-OR29474