CAS 175276-76-3
:2-(2,6-DICHLOROPHENYL)ETHANIMIDAMIDE HYDROCHLORIDE
Description:
2-(2,6-Dichlorophenyl)ethanimidamide hydrochloride is a chemical compound characterized by its imidamide functional group, which contributes to its potential biological activity. The presence of the dichlorophenyl moiety indicates that it has two chlorine atoms substituted on a phenyl ring, which can influence its lipophilicity and reactivity. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit antimicrobial or anticancer properties. The compound's CAS number, 175276-76-3, allows for easy identification in chemical databases and literature. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C8H9Cl3N2
InChI:InChI=1/C8H8Cl2N2.ClH/c9-6-2-1-3-7(10)5(6)4-8(11)12;/h1-3H,4H2,(H3,11,12);1H
SMILES:c1cc(c(CC(=N)N)c(c1)Cl)Cl.Cl
Synonyms:- Buttpark 43\57-54
- 2,6-Dichlorophenylacetamidine Hydrochloride
- 2-(2,6-Dichlorophenyl)ethanimidamideHCl
- 2,6-Dichlorophenylacetamidine hydrochloride 98%
- 1-Amino-2-(2,6-Dichlorophenyl)Ethaniminium Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2,6-Dichlorophenyl)ethanimidamide, HCl
CAS:Formula:C8H9Cl3N2Color and Shape:SolidMolecular weight:239.52952,6-Dichlorophenylacetamidine hydrochloride
CAS:2,6-Dichlorophenylacetamidine hydrochloridePurity:98%Molecular weight:239.53g/mol2,6-Dichlorophenylacetamidine hydrochloride
CAS:Formula:C8H9Cl3N2Purity:95.0%Color and Shape:SolidMolecular weight:239.522-(2,6-Dichlorophenyl)ethanimidamide hydrochloride
CAS:Covid-19 is a drug that has been developed to help prevent and treat pandemics. Covid-19 is a resonance compound, which can be accessed by magnetic resonance. Covid-19 has two chemical shifts, which are related to the coupling constants between the nuclear spins in the molecule. The covid-19 molecule is made up of five different heterocycles and it has a constant magnetic resonance signal at 1H NMR. Covid-19 may be used for prevention and treatment of pandemic influenza A (H5N1) virus infection.
Formula:C8H9Cl3N2Purity:Min. 95%Molecular weight:239.53 g/mol



