CAS 175276-90-1

3-Methyl-5-[4-(trifluoromethyl)phenyl]isoxasole-4-carboxylic acid hydrazide

Description:

3-Methyl-5-[4-(trifluoromethyl)phenyl]isoxazole-4-carboxylic acid hydrazide is a chemical compound characterized by its isoxazole core, which features a methyl group and a hydrazide functional group. The presence of a trifluoromethyl group on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is typically used in pharmaceutical research and development due to its potential as a bioactive molecule. Its structure suggests it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. The hydrazide moiety can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the trifluoromethyl group, which is known for its electron-withdrawing properties. Overall, 3-Methyl-5-[4-(trifluoromethyl)phenyl]isoxazole-4-carboxylic acid hydrazide represents a unique structure that may offer valuable insights in medicinal chemistry.

Formula: C₁₂H₁₀F₃N₃O₂

InChI: InChI=1/C12H10F3N3O2/c1-6-9(11(19)17-16)10(20-18-6)7-2-4-8(5-3-7)12(13,14)15/h2-5H,16H2,1H3,(H,17,19)

SMILES: Cc1c(c(c2ccc(cc2)C(F)(F)F)on1)C(=NN)O

Synonyms:

• Methyltrifluoromethylphenylisoxasolecarboxylicacidhydrazide
• Ethyl 2-(2,4-Difluorophenyl)-1,3-Thiazole-4-Carboxylate
• 3-Methyl-5-[4-(Trifluoromethyl)Phenyl]Isoxazole-4-Carbohydrazide

3-Methyl-5-(4-(trifluoromethyl)phenyl)isoxazole-4-carbohydrazide

CAS: 175276-90-1

Formula: C₁₂H₁₀F₃N₃O₂

Color and Shape: Solid

Molecular weight: 285.2219

Ref: IN-DA0020RQ

3-Methyl-5-[(4-trifluoromethyl)phenyl]isoxazole-4-carboxylic hydrazide

CAS: 175276-90-1

3-Methyl-5-[(4-trifluoromethyl)phenyl]isoxazole-4-carboxylic hydrazide

Purity: ≥95%

Molecular weight: 285.22g/mol

Ref: 54-PC4306