
CAS 175277-28-8
:Ethyl 2-(5-methyl-3-isoxazolyl)-4-thiazolecarboxylate
Description:
Ethyl 2-(5-methyl-3-isoxazolyl)-4-thiazolecarboxylate is a chemical compound characterized by its unique structural features, which include an ethyl ester group, an isoxazole ring, and a thiazole moiety. The presence of the isoxazole ring contributes to its potential biological activity, as this heterocyclic structure is often associated with various pharmacological properties. The thiazole component adds to the compound's reactivity and may influence its interactions with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its versatility in synthetic chemistry. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through appropriate studies.
Formula:C10H10N2O3S
InChI:InChI=1S/C10H10N2O3S/c1-3-14-10(13)8-5-16-9(11-8)7-4-6(2)15-12-7/h4-5H,3H2,1-2H3
InChI key:InChIKey=KEJQOOHKWIDPHE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C(SC1)C2=NOC(C)=C2
Synonyms:- Ethyl 2-(5-methyl-3-isoxazolyl)-4-thiazolecarboxylate
- 4-Thiazolecarboxylic acid, 2-(5-methyl-3-isoxazolyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Thiazolecarboxylic acid, 2-(5-methyl-3-isoxazolyl)-, ethyl ester
CAS:Formula:C10H10N2O3SMolecular weight:238.263
