CymitQuimica logo

CAS 175277-42-6

:

6-ACETYL-2-MERCAPTONICOTINONITRILE

Description:
6-Acetyl-2-mercaptonicotinonitrile, identified by its CAS number 175277-42-6, is a chemical compound that belongs to the class of heterocyclic compounds, specifically derivatives of nicotinonitrile. This substance features a mercapto group (-SH) and an acetyl group (-COCH3) attached to a pyridine ring, which contributes to its unique chemical properties. The presence of the mercapto group imparts thiol characteristics, making it reactive in various chemical reactions, particularly in nucleophilic substitutions and redox reactions. The nitrile group (-C≡N) enhances its polarity and can participate in coordination with metal ions, making it of interest in coordination chemistry. Additionally, the compound may exhibit biological activity, which could be explored for potential applications in pharmaceuticals or agrochemicals. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many chemical substances, handling should be done with care, considering safety protocols due to potential toxicity associated with thiol compounds.
Formula:C8H6N2OS
InChI:InChI=1/C8H6N2OS/c1-5(11)7-3-2-6(4-9)8(12)10-7/h2-3H,1H3,(H,10,12)
InChI key:BMIYKADARYWNMG-UHFFFAOYSA-N
SMILES:CC(=O)c1ccc(C#N)c(n1)S
Synonyms:
  • 6-Acetyl-2-Mercaptopyridine-3-Carbonitrile
  • 6-Acetyl-2-Thioxo-1,2-Dihydropyridine-3-Carbonitrile
Found 3 products.