CymitQuimica logo

CAS 175277-52-8

:

3-Chloro-2-(chloromethyl)-5-(trifluoromethyl)pyridine

Description:
3-Chloro-2-(chloromethyl)-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of multiple substituents, including a chloro group and a trifluoromethyl group, significantly influences its chemical properties. The chloro and chloromethyl groups enhance its reactivity, making it a potential intermediate in various synthetic pathways. The trifluoromethyl group is known for imparting unique electronic properties, often increasing lipophilicity and altering the compound's biological activity. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of agrochemicals and other fine chemicals. Its molecular structure contributes to its potential applications in medicinal chemistry, where modifications can lead to compounds with desired biological activities. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C7H4Cl2F3N
InChI:InChI=1S/C7H4Cl2F3N/c8-2-6-5(9)1-4(3-13-6)7(10,11)12/h1,3H,2H2
InChI key:InChIKey=NUSXEDNPFNWFDQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(Cl)C(CCl)=NC1
Synonyms:
  • 3-Chloro-2-(chloromethyl)-5-trifluoromethylpyridine
  • Ethyl 4-Methyl-2-[5-(Trifluoromethyl)Pyridin-2-Yl]-1,3-Thiazole-5-Carboxylate
  • Pyridine, 3-chloro-2-(chloromethyl)-5-(trifluoromethyl)-
  • 3-Chloro-2-(chloromethyl)-5-(trifluoromethyl)pyridine
Found 3 products.