CymitQuimica logo

CAS 175277-73-3

:

Ethyl 2-chloro-3-cyano-6-(trifluoromethyl)pyridine-5-carboxylate

Description:
Ethyl 2-chloro-3-cyano-6-(trifluoromethyl)pyridine-5-carboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features several functional groups, including a chloro group, a cyano group, and a trifluoromethyl group, which contribute to its chemical reactivity and properties. The presence of the ethyl ester group indicates that it can participate in esterification reactions and may exhibit moderate polarity due to the electronegative chlorine and fluorine atoms. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. Additionally, the cyano group can serve as a versatile handle for further chemical modifications. Overall, this compound's unique combination of functional groups and its pyridine framework make it a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C7H7Cl2F3N2
InChI:InChI=1/C7H6ClF3N2.ClH/c8-5-1-4(7(9,10)11)3-13-6(5)2-12;/h1,3H,2,12H2;1H
InChI key:PMDLSQHFIADYJD-UHFFFAOYSA-N
SMILES:c1c(cnc(CN)c1Cl)C(F)(F)F.Cl
Synonyms:
  • Ethyl 2-chloro-3-cyano-6-(trifluoromethyl)
  • Ethyl 6-Chloro-5-Cyano-2-(Trifluoromethyl)Pyridine-3-Carboxylate
  • 1-[3-Chloro-5-(Trifluoromethyl)Pyridin-2-Yl]Methanamine Hydrochloride
Found 4 products.