CymitQuimica logo

CAS 175277-93-7

:

2-Amino-6-fluorobenzylamine

Description:
2-Amino-6-fluorobenzylamine is an organic compound characterized by the presence of an amino group and a fluorine atom attached to a benzene ring. The molecular structure features a benzylamine backbone, where the amino group (-NH2) is positioned at the 2nd carbon and a fluorine atom is located at the 6th carbon of the aromatic ring. This compound is typically a colorless to pale yellow solid and is soluble in polar solvents due to its amino functional group. It exhibits basic properties due to the presence of the amino group, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The fluorine atom can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and material science. Additionally, 2-Amino-6-fluorobenzylamine may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, highlighting its significance in organic synthesis and chemical research.
Formula:C7H9FN2
InChI:InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2
InChI key:KBIXYFABFIYSAU-UHFFFAOYSA-N
SMILES:c1cc(c(CN)c(c1)N)F
Synonyms:
  • 2-(Aminomethyl)-3-fluoroaniline
Found 4 products.