CAS 175278-17-8: 2-Bromo-4-trifluoromethoxyaniline
Description:2-Bromo-4-trifluoromethoxyaniline is an organic compound characterized by the presence of a bromine atom, a trifluoromethoxy group, and an aniline structure. Its molecular formula typically includes carbon, hydrogen, bromine, oxygen, and fluorine atoms, reflecting its complex structure. The bromine substituent introduces a degree of reactivity, while the trifluoromethoxy group enhances its electron-withdrawing properties, influencing its chemical behavior and interactions. This compound is likely to exhibit moderate to high polarity due to the presence of electronegative fluorine and oxygen atoms, which can affect its solubility in various solvents. Additionally, the aniline moiety suggests potential for hydrogen bonding, which may further influence its physical properties. 2-Bromo-4-trifluoromethoxyaniline may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its unique functional groups that can participate in various chemical reactions. Safety and handling precautions should be observed, as halogenated compounds can pose health and environmental risks.
Formula:C7H5BrF3NO
InChI:InChI=1S/C7H5BrF3NO/c8-5-3-4(1-2-6(5)12)13-7(9,10)11/h1-3H,12H2
InChI key:InChIKey=ROSTYHNIIDIBEG-UHFFFAOYSA-N
SMILES:FC(F)(F)OC1=CC=C(N)C(Br)=C1
- Synonyms:
- 2-Bromo-4-(trifluoromethoxy)benzenamine
- 2-Bromo-4-(trifluoromethyloxy)aniline
- 2-Bromo-4-Tirfluoromethoxyaniline
- 2-Bromo-4-trifluoromethoxyaniline
- Benzenamine, 2-bromo-4-(trifluoromethoxy)-
- N-[4-bromo-2-(trifluoromethoxy)phenyl]acetamide
