CymitQuimica logo

CAS 175278-20-3

:

4-(Trifluoromethoxy)ethylaminobenzene

Description:
4-(Trifluoromethoxy)ethylaminobenzene, with the CAS number 175278-20-3, is an organic compound characterized by the presence of a trifluoromethoxy group and an ethylamino group attached to a benzene ring. This compound typically exhibits properties associated with aromatic amines, including potential solubility in organic solvents and moderate stability under standard conditions. The trifluoromethoxy group contributes to its unique electronic properties, potentially enhancing its reactivity and influencing its interactions with other chemical species. The presence of fluorine atoms often imparts increased lipophilicity and can affect the compound's biological activity. As with many fluorinated compounds, it may exhibit distinct characteristics in terms of volatility and thermal stability. Safety considerations are important, as compounds containing fluorine can pose environmental and health risks. Overall, 4-(Trifluoromethoxy)ethylaminobenzene is of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features and potential applications.
Formula:C9H10F3NO
InChI:InChI=1/C9H10F3NO/c1-2-13-7-3-5-8(6-4-7)14-9(10,11)12/h3-6,13H,2H2,1H3
SMILES:CCNc1ccc(cc1)OC(F)(F)F
Synonyms:
  • N1-Ethyl-4-(trifluoromethoxy)aniline
  • N-ethyl-4-(trifluoromethoxy)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.