CAS 175278-41-8: 3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
Description:3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid, with the CAS number 175278-41-8, is a chemical compound that features a complex structure characterized by the presence of an acrylic acid moiety and a substituted phenyl group. The compound contains a nitro group and a tetrahydro-pyrrole ring, which contribute to its unique chemical properties. It is likely to exhibit both acidic and basic characteristics due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the nitro group may enhance its reactivity and influence its electronic properties, potentially making it useful in organic synthesis or as an intermediate in pharmaceutical applications. Additionally, the compound's structural features suggest it may have specific interactions with biological targets, which could be of interest in medicinal chemistry. However, detailed studies on its solubility, stability, and biological activity would be necessary to fully understand its potential applications and safety profile.
Formula:C13H14N2O4
InChI:InChI=1S/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)
InChI key:InChIKey=UDLTYRICBOUKIU-UHFFFAOYSA-N
SMILES:O=C(O)C=CC1=CC=C(C(=C1)N(=O)=O)N2CCCC2
- Synonyms:
- (2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-[3-nitro-4-(1-pyrrolidinyl)phenyl]-
- 3-[3-Nitro-4-(1-pyrrolidinyl)phenyl]-2-propenoic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-Propenoic acid, 3-[3-nitro-4-(1-pyrrolidinyl)phenyl]- REF: IN-DA0020U5CAS: 175278-41-8 | - - - | To inquire | Wed 26 Mar 25 |
 | 3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid REF: 54-OR30320CAS: 175278-41-8 | 95 | 68.00 €~109.00 € | Thu 27 Mar 25 |
 | 3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid REF: 10-F065698CAS: 175278-41-8 | 97% | - - - | Discontinued product |
 | 3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid REF: 3D-AHA27841CAS: 175278-41-8 | Min. 95% | - - - | Discontinued product |
![2-Propenoic acid, 3-[3-nitro-4-(1-pyrrolidinyl)phenyl]-](https://static.cymitquimica.com/products/IN/thumb/DA0020U5.jpg)
2-Propenoic acid, 3-[3-nitro-4-(1-pyrrolidinyl)phenyl]-
Ref: IN-DA0020U5
| Undefined size | To inquire |
3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
Ref: 54-OR30320
| 1g | 109.00 € | ||
| 100mg | 68.00 € | ||
| 250mg | 76.00 € | ||
| 500mg | 95.00 € |
3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
Ref: 10-F065698
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
3-(3-Nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid
Ref: 3D-AHA27841
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
