CAS 175278-43-0
:5-Nitro-2-[(phenylmethyl)thio]benzaldehyde
Description:
5-Nitro-2-[(phenylmethyl)thio]benzaldehyde is an organic compound characterized by its aromatic structure, which includes a nitro group and a thioether functional group. The presence of the nitro group (-NO2) typically imparts electron-withdrawing properties, influencing the compound's reactivity and polarity. The thioether moiety, represented by the phenylmethylthio group, contributes to the compound's overall hydrophobic character and can affect its solubility in various solvents. This compound is likely to exhibit moderate stability under standard conditions but may be sensitive to strong oxidizing agents due to the presence of the nitro group. Its unique structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for its identification and characterization in laboratory settings. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity and reactivity.
Formula:C14H11NO3S
InChI:InChI=1/C14H11NO3S/c16-9-12-8-13(15(17)18)6-7-14(12)19-10-11-4-2-1-3-5-11/h1-9H,10H2
InChI key:InChIKey=COWMUQNZNYZPLS-UHFFFAOYSA-N
SMILES:S(CC1=CC=CC=C1)C2=C(C=O)C=C(N(=O)=O)C=C2
Synonyms:- 2-(Benzylmercapto)-5-nitrobenzaldehyde
- 2-(Benzylsulfanyl)-5-Nitrobenzaldehyde
- 2-(Benzylsulfanyl)-5-Nitrobenzenecarbaldehyde
- 5-Nitro-2-[(phenylmethyl)thio]benzaldehyde
- Benzaldehyde, 5-nitro-2-[(phenylmethyl)thio]-
- 2-Benzylthio-5-nitrobenzaldehyde
- 5-nitro-2-(phenylmethylthio)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(Benzylthio)-5-nitrobenzaldehyde
CAS:2-(Benzylthio)-5-nitrobenzaldehyde
Molecular weight:273.31g/mol

