![3-Nitro-4-[(phenylmethyl)thio]benzaldehyde](https://static.cymitquimica.com/cas-image/225533-3-nitro-4-phenylmethyl-thio-benzaldehyde.png)
CAS 175278-44-1: 3-Nitro-4-[(phenylmethyl)thio]benzaldehyde
Description:3-Nitro-4-[(phenylmethyl)thio]benzaldehyde is an organic compound characterized by its complex structure, which includes a nitro group, a thioether linkage, and an aldehyde functional group. The presence of the nitro group typically imparts electron-withdrawing properties, influencing the compound's reactivity and polarity. The thioether moiety, derived from the phenylmethyl group, contributes to the compound's overall hydrophobic character and can affect its solubility in various solvents. As an aldehyde, it is likely to participate in typical reactions associated with this functional group, such as oxidation and condensation reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on its molecular interactions and the environment in which it is studied. Overall, 3-Nitro-4-[(phenylmethyl)thio]benzaldehyde is a versatile compound with potential applications in various chemical and pharmaceutical fields.
Formula:C14H11NO3S
InChI:InChI=1S/C14H11NO3S/c16-9-12-6-7-14(13(8-12)15(17)18)19-10-11-4-2-1-3-5-11/h1-9H,10H2
InChI key:InChIKey=UIXPQYSMFXQEMB-UHFFFAOYSA-N
SMILES:O=CC1=CC=C(SCC=2C=CC=CC2)C(=C1)N(=O)=O
- Synonyms:
- 3-Nitro-4-[(phenylmethyl)thio]benzaldehyde
- 4-(Benzylsulfanyl)-3-Nitrobenzaldehyde
- Benzaldehyde, 3-nitro-4-[(phenylmethyl)thio]-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Benzaldehyde, 3-nitro-4-[(phenylmethyl)thio]- REF: IN-DA0020U2CAS: 175278-44-1 | - - - | To inquire | Wed 26 Mar 25 |
 | 4-(Benzylthio)-3-nitrobenzaldehyde REF: 54-OR30328CAS: 175278-44-1 | - - - | 32.00 €~36.00 € | Thu 27 Mar 25 |
 | 4-(Benzylthio)-3-nitrobenzaldehyde REF: 10-F727690CAS: 175278-44-1 | 95+% | - - - | Discontinued product |
 | 4-(Benzylthio)-3-nitrobenzaldehyde REF: 3D-AHA27844CAS: 175278-44-1 | Min. 95% | - - - | Discontinued product |
![Benzaldehyde, 3-nitro-4-[(phenylmethyl)thio]-](https://static.cymitquimica.com/products/IN/thumb/DA0020U2.jpg)
Benzaldehyde, 3-nitro-4-[(phenylmethyl)thio]-
Ref: IN-DA0020U2
| Undefined size | To inquire |
Ref: 54-OR30328
| 100mg | 32.00 € | ||
| 250mg | 36.00 € |
Ref: 10-F727690
| 1g | Discontinued | Request information |
4-(Benzylthio)-3-nitrobenzaldehyde
Ref: 3D-AHA27844
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
