CAS 175278-64-5
:4-Bromobenzenesulfinic acid sodium salt dihydrate
Description:
4-Bromobenzenesulfinic acid sodium salt dihydrate is an organosulfur compound characterized by its sulfinic acid functional group attached to a bromobenzene ring. As a sodium salt, it is typically soluble in water, which is enhanced by the presence of two water molecules in its dihydrate form. This compound is often utilized in organic synthesis, particularly in the preparation of various sulfonamides and as a reagent in chemical reactions due to its electrophilic nature. The presence of the bromine atom on the benzene ring can influence its reactivity, making it a useful intermediate in the synthesis of more complex organic molecules. Additionally, the sulfinic acid group imparts unique properties, such as potential antioxidant activity and the ability to act as a reducing agent. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during use.
Formula:C6H8BrNaO4S
InChI:InChI=1/C6H5BrO2S.Na.2H2O/c7-5-1-3-6(4-2-5)10(8)9;;;/h1-4H,(H,8,9);;2*1H2/q;+1;;/p-1
Synonyms:- Sodium 4-Bromobenzene-1-Sulfinate Dihydrate
- 4-Bromobenzenesulfinic Acid
- 4-Bromobenzenesulfonic Acid Sodium Salt Dihydrate
- Buttpark 120\07-61
- Sodium 4-Bromobenzene-1-Sulphinate Dihydrate
- 4-Bromobenzenesulfinic Acid Sodium Salt
- 4-Bromobenzenesulfinic acid sodium salt dihydrate, tech., 97%
- Sodium 4-Bromobenzenesulfinate Dihydrate
- Benzenesulfinic acid,4-bromo-, sodium salt, hydrate (1:1:2)
- Benzenesulfinicacid, 4-bromo-, sodium salt, dihydrate (9CI)
- 4-bromo Benzene sulfinic acid sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromobenzenesulfinic acid sodium salt dihydrate, 97%
CAS:4-Bromobenzenesulfinic acid sodium salt dehydrate is used in the preparation of unsymmetrical internal alkynes and vinyl sulfones by reaction with alkynes by using palladium as a catalyst. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some do
Formula:C6H4BrNaO2S•2H2OPurity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:279.09 (243.06anhy)Sodium 4-bromobenzenesulfinate, dihydrate
CAS:Formula:C6H8BrNaO4SPurity:98%Color and Shape:SolidMolecular weight:279.0841Sodium 4-bromobenzene-1-sulphinate dihydrate
CAS:Sodium 4-bromobenzene-1-sulphinate dihydrateFormula:C6H4BrO2S·Na·2H2OPurity:98%Color and Shape: fine white powderMolecular weight:279.08g/mol



