CAS 175281-76-2
:4-[4-(1-hydroxyethyl)-2-methoxy-5-nitro-phenoxy]butyric acid
Description:
4-[4-(1-Hydroxyethyl)-2-methoxy-5-nitro-phenoxy]butyric acid, with the CAS number 175281-76-2, is a chemical compound characterized by its complex structure, which includes a butyric acid moiety linked to a phenolic group that features a hydroxyethyl substituent, a methoxy group, and a nitro group. This compound is typically classified as an aromatic compound due to the presence of the phenoxy group, which contributes to its potential biological activity. The hydroxyethyl group may enhance solubility and reactivity, while the nitro group can impart specific electronic properties, influencing the compound's interactions in biological systems. The methoxy group can also affect the compound's lipophilicity and overall stability. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Understanding the characteristics of this compound, including its solubility, stability, and reactivity, is crucial for its application in research and industry.
Formula:C13H17NO7
InChI:InChI=1/C13H17NO7/c1-8(15)9-6-11(20-2)12(7-10(9)14(18)19)21-5-3-4-13(16)17/h6-8,15H,3-5H2,1-2H3,(H,16,17)
SMILES:CC(c1cc(c(cc1N(=O)=O)OCCCC(=O)O)OC)O
Synonyms:- 4-[4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy]butyric acid
- 4-[4-(1-Hydroxyethyl)-2-Methoxy-5-Nitrophenoxy]Butanoic Acid
- 4-(4-(1-Hydroxyethyl)-2-methoxy-5-nitro-phenoxy)butyric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Butanoic acid, 4-[4-(1-hydroxyethyl)-2-methoxy-5-nitrophenoxy]-
CAS:Formula:C13H17NO7Purity:97%Color and Shape:SolidMolecular weight:299.27664-(4-(1-Hydroxyethyl)-2-Methoxy-5-Nitro-Phenoxy)Butylic Acid
CAS:4-(4-(1-Hydroxyethyl)-2-Methoxy-5-Nitro-Phenoxy)Butylic AcidPurity:97%Molecular weight:299.28g/mol4-(4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy)butyric acid
CAS:Controlled Product4-(4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy)butyric acid (4HEMNPAB) is a reactive molecule that inhibits the growth of cancer cells. It has been shown to be effective against human epidermoid carcinoma cells in culture and has also been used as a model for the development of nanogel formulations. 4HEMNPAB inhibits cell division by binding to the amide function on the target cell, which prevents it from replicating. This drug is cytostatic, meaning that it slows down cancer cell growth but does not kill cells.Formula:C13H17NO7Purity:Min. 95%Color and Shape:PowderMolecular weight:299.28 g/mol4-(4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy)butanoic acid
CAS:Formula:C13H17NO7Purity:95%Color and Shape:SolidMolecular weight:299.2794-[4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy]butanoic Acid
CAS:Formula:C13H17NO7Color and Shape:Yellow SolidMolecular weight:299.2766





