CymitQuimica logo

CAS 175281-76-2

:

4-[4-(1-hydroxyethyl)-2-methoxy-5-nitro-phenoxy]butyric acid

Description:
4-[4-(1-Hydroxyethyl)-2-methoxy-5-nitro-phenoxy]butyric acid, with the CAS number 175281-76-2, is a chemical compound characterized by its complex structure, which includes a butyric acid moiety linked to a phenolic group that features a hydroxyethyl substituent, a methoxy group, and a nitro group. This compound is typically classified as an aromatic compound due to the presence of the phenoxy group, which contributes to its potential biological activity. The hydroxyethyl group may enhance solubility and reactivity, while the nitro group can impart specific electronic properties, influencing the compound's interactions in biological systems. The methoxy group can also affect the compound's lipophilicity and overall stability. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Understanding the characteristics of this compound, including its solubility, stability, and reactivity, is crucial for its application in research and industry.
Formula:C13H17NO7
InChI:InChI=1/C13H17NO7/c1-8(15)9-6-11(20-2)12(7-10(9)14(18)19)21-5-3-4-13(16)17/h6-8,15H,3-5H2,1-2H3,(H,16,17)
InChI key:DUIJUTBRRZCWRD-UHFFFAOYSA-N
SMILES:CC(c1cc(c(cc1N(=O)=O)OCCCC(=O)O)OC)O
Synonyms:
  • 4-[4-(1-Hydroxyethyl)-2-methoxy-5-nitrophenoxy]butyric acid
  • 4-[4-(1-Hydroxyethyl)-2-Methoxy-5-Nitrophenoxy]Butanoic Acid
  • 4-(4-(1-Hydroxyethyl)-2-methoxy-5-nitro-phenoxy)butyric acid
Found 6 products.