CAS 1753-50-0

5-Pyrimidinecarbonitrile, 2-chloro- (7CI,8CI)

Description:

5-Pyrimidinecarbonitrile, 2-chloro- (CAS 1753-50-0) is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a cyano group (-C≡N) at the 5-position and a chlorine atom at the 2-position contributes to its reactivity and potential applications in various chemical syntheses. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure allows for participation in nucleophilic substitution reactions, making it useful in the synthesis of pharmaceuticals and agrochemicals. Additionally, the chlorine substituent can influence the compound's electronic properties, potentially enhancing its biological activity. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 5-Pyrimidinecarbonitrile, 2-chloro- is a valuable compound in organic chemistry with diverse applications.

Formula: C₅H₂ClN₃

InChI: InChI=1/C5H2ClN3/c6-5-8-2-4(1-7)3-9-5/h2-3H

SMILES: C(#N)c1cnc(Cl)nc1

Synonyms:

• 5-Pyrimidinecarbonitrile, 2-chloro-
• 2-Chloropyrimidine-5-Carbonitrile
• 2-Chloro-5-pyrimidinecarbonitrile

5-Pyrimidinecarbonitrile, 2-chloro-

CAS: 1753-50-0

Formula: C₅H₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.5425

Ref: IN-DA0020VR

2-Chloropyrimidine-5-carbonitrile

CAS: 1753-50-0

2-Chloropyrimidine-5-carbonitrile

Formula: C₅H₂ClN₃

Purity: ≥95%

Color and Shape: light yellow crystalline powder

Molecular weight: 139.54g/mol

Ref: 54-OR310354

2-Chloro-5-pyrimidinecarbonitrile

CAS: 1753-50-0

Formula: C₅H₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.54

Ref: 10-F077225