CAS 1753-68-0
:2,5-bis(1-piperidylmethyl)benzene-1,4-diol
Description:
2,5-bis(1-piperidylmethyl)benzene-1,4-diol, with the CAS number 1753-68-0, is an organic compound characterized by its structure, which features a benzene ring substituted with two piperidylmethyl groups and two hydroxyl (–OH) groups at the 1 and 4 positions. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The piperidine rings contribute to its basicity and potential for forming various interactions, making it of interest in medicinal chemistry and material science. The hydroxyl groups enhance its reactivity, allowing for further functionalization. Additionally, the compound may exhibit biological activity, which could be explored for pharmaceutical applications. Its synthesis and characterization involve standard organic chemistry techniques, and it is important to handle it with care, following appropriate safety protocols due to potential toxicity associated with piperidine derivatives.
Formula:C18H28N2O2
InChI:InChI=1/C18H28N2O2/c21-17-12-16(14-20-9-5-2-6-10-20)18(22)11-15(17)13-19-7-3-1-4-8-19/h11-12,21-22H,1-10,13-14H2
SMILES:C1CCN(CC1)Cc1cc(c(cc1O)CN1CCCCC1)O
Synonyms:- 1,4-Benzenediol, 2,5-bis(1-piperidinylmethyl)-
- 2,5-Bis(piperidin-1-ylmethyl)benzene-1,4-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,5-Bis-piperidin-1-ylmethyl-benzene-1,4-diol
CAS:Formula:C18H28N2O2Color and Shape:SolidMolecular weight:304.434

