CAS 175354-32-2
:TRIS(1H,1H,2H,2H-PERFLUOROOCTYL)TIN HYDRIDE
Description:
Tris(1H,1H,2H,2H-perfluorooctyl)tin hydride, with the CAS number 175354-32-2, is an organotin compound characterized by its unique structure, which includes three perfluorooctyl groups attached to a tin atom, along with a hydride. This compound is notable for its high degree of fluorination, which imparts significant hydrophobic and lipophobic properties, making it useful in various applications, including as a surface modifier and in specialty coatings. The presence of tin in its structure contributes to its potential use in organometallic chemistry and catalysis. Additionally, the perfluorinated chains enhance its thermal stability and resistance to chemical degradation. However, due to the environmental and health concerns associated with organotin compounds, including potential toxicity and bioaccumulation, the use and handling of tris(1H,1H,2H,2H-perfluorooctyl)tin hydride must be approached with caution, adhering to safety regulations and guidelines. Overall, this compound exemplifies the intersection of organometallic chemistry and fluorinated materials, showcasing both unique properties and challenges.
Formula:C24H13F39Sn
InChI:InChI=1/3C8H4F13.Sn.H/c3*1-2-3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;;/h3*1-2H2;;/rC24H13F39Sn/c25-7(26,10(31,32)13(37,38)16(43,44)19(49,50)22(55,56)57)1-4-64(5-2-8(27,28)11(33,34)14(39,40)17(45,46)20(51,52)23(58,59)60)6-3-9(29,30)12(35,36)15(41,42)18(47,48)21(53,54)24(61,62)63/h64H,1-6H2
SMILES:C(C[Sn](CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- Pfth
- Tris(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl)Tin Hydride
- Tris[2-(Perfluorohexyl)Ethyl]Tin Hydride
- Curran-Hadida Reagent
- PTFH, Curran-Hadida reagent
- Curran-Hadida reagent, Tris[2-(perfluorohexyl)ethyl]tin hydride, Tris(1H,1H,2H,2H-perfluorooctyl)tin hydride
- Tris(2-perfluorohexylethyl)tin hydride
- Tris(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl)Stannane
- PTFH, Curran-Hadida reagent, Tris(1H,1H,2H,2H-perfluorooctyl)tin hydride, Tris[2-(perfluorohex-1-yl)ethyl]tin hydride
- Tris(1H,1H,2H,2H-tridecafluorooct-1-yl)tin hydride
- Tris[2-(perfluorohexyl)ethyl]tin hydride,90%,tech.
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Tris(1H,1H,2H,2H-tridecafluorooct-1-yl)tin hydride
CAS:Tris(1H,1H,2H,2H-tridecafluorooct-1-yl)tin hydride
Color and Shape:LiquidMolecular weight:1,160.00g/mol

