CAS 175358-01-7

6-Chloro-3-aminopyridine-2-carboxamide

Description:

6-Chloro-3-aminopyridine-2-carboxamide is a chemical compound characterized by its pyridine ring structure, which is substituted with a chlorine atom and an amino group, as well as a carboxamide functional group. The presence of the chlorine atom at the 6-position and the amino group at the 3-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxamide group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit antimicrobial or anti-inflammatory properties. Additionally, the presence of both electron-withdrawing (chlorine) and electron-donating (amino) groups can influence its electronic properties, making it a candidate for further research in various chemical and biological contexts. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₆H₆ClN₃O

InChI: InChI=1/C6H6ClN3O/c7-4-2-1-3(8)5(10-4)6(9)11/h1-2H,8H2,(H2,9,11)

SMILES: c1cc(Cl)nc(c1N)C(=N)O

Synonyms:

• 3-Amino-6-Chloropicolinamide
• 3-Amino-6-Chloropyridine-2-Carboxamide

2-Pyridinecarboxamide, 3-amino-6-chloro-

CAS: 175358-01-7

Formula: C₆H₆ClN₃O

Purity: 96%

Color and Shape: Solid

Molecular weight: 171.5843

Ref: IN-DA0020XN

3-Amino-6-chloropyridine-2-carboxamide

CAS: 175358-01-7

3-Amino-6-chloropyridine-2-carboxamide

Purity: 98%

Molecular weight: 171.58g/mol

Ref: 54-OR322132

6-Chloro-3-aminopyridine-2-carboxamide

CAS: 175358-01-7

6-Chloro-3-aminopyridine-2-carboxamide is a small molecule that inhibits tumor growth in human prostate cancer cells. It binds to a pharmacophore, which is a three dimensional arrangement of atoms that is responsible for the biological activity of the drug. This compound has been shown to inhibit tumor cell proliferation and induce apoptosis. 6-Chloro-3-aminopyridine-2-carboxamide also inhibits the oncogenic signaling pathways, including the PI3K/Akt and MAPK pathways, leading to antiproliferative activity in cancer cell lines. 6-Chloro-3-aminopyridine-2-carboxamide also inhibits phosphorylation of Akt and Erk1/2, which are downstream targets of PI3K/Akt pathway activation. The compound was found to have no significant effects on noncancerous cells or normal prostate tissue.

Formula: C₆H₆ClN₃O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 171.58 g/mol

Ref: 3D-FC07007

3-Amino-6-chloropyridine-2-carboxamide

CAS: 175358-01-7

Formula: C₆H₆ClN₃O

Purity: 96%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F068511