CAS 175463-14-6
:Gemifloxacin
Description:
Gemifloxacin is a synthetic fluoroquinolone antibiotic characterized by its broad-spectrum antibacterial activity, particularly against respiratory pathogens. It is primarily used to treat respiratory tract infections, including pneumonia and bronchitis. The chemical structure of gemifloxacin features a bicyclic core with a fluorine atom, which enhances its potency and spectrum of activity. It exhibits a mechanism of action that involves the inhibition of bacterial DNA gyrase and topoisomerase IV, enzymes crucial for DNA replication and repair. Gemifloxacin is known for its favorable pharmacokinetic properties, including good oral bioavailability and a relatively long half-life, allowing for once-daily dosing. Additionally, it has a lower propensity for developing resistance compared to some other antibiotics in its class. However, like all antibiotics, it is essential to use gemifloxacin judiciously to minimize the risk of resistance development. Common side effects may include gastrointestinal disturbances and potential effects on the central nervous system. As with any medication, it is important to consider individual patient factors and potential drug interactions when prescribing gemifloxacin.
Formula:C18H20FN5O4
InChI:InChI=1/C18H20FN5O4/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27)/b22-14+
InChI key:InChIKey=ZRCVYEYHRGVLOC-HYARGMPZNA-N
SMILES:O=C1C=2C(N(C=C1C(O)=O)C3CC3)=NC(=C(F)C2)N4C/C(=N\OC)/C(CN)C4
Synonyms:- 1,8-Naphthyridine-3-carboxylic acid, 7-[(4Z)-3-(aminomethyl)-4-(methoxyimino)-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-
- 7-(3-Aminomethyl)-4-Methoxyimino-Pyrrolidin-1-Yl)-1-Cyclopropyl-6-Fluoro-4-Oxo-1, 4-Dihydro-[1, 8]Naphthyridine-3-Carboxylic Acid
- 7-3(Aminomethyl-4-(Z)-methoxyimino-1-pyrrolidinyl)-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthylridine-3-carboxylic acid
- 7-[(4E)-3-(aminomethyl)-4-(methoxyimino)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid methanesulfonate
- 7-[(4Z)-3-(Aminomethyl)-4-(methoxyimino)-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acid
- 7-[(4Z)-3-(aminomethyl)-4-(methoxyimino)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid
- 7-[3-(Aminomethyl)-4-(methoxyimino)-1-pyrrolidinyl]-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic Acid Mesilate
- Gemifloxacin
- Lb 20304
- Sb 265805
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Gemifloxacin
CAS:Gemifloxacin is a fluoronaphthyridone with strong antibacterial effect.Formula:C18H20FN5O4Purity:98%Color and Shape:SolidMolecular weight:389.38Acyl Glucuronide - Gemifloxacin
CAS:Controlled ProductFormula:C24H28FN5O10Color and Shape:NeatMolecular weight:565.505Gemifioxacin
CAS:Gemifloxacin is an antibacterial agent primarily classified as a fluoroquinolone antibiotic, which is a synthetic compound derived from chemical processes in pharmaceutical manufacturing. Its mechanism of action involves the inhibition of key bacterial enzymes, namely DNA gyrase and topoisomerase IV. These enzymes are crucial for bacterial DNA replication, transcription, repair, and recombination. By obstructing these enzymes, Gemifloxacin effectively inhibits bacterial cell division and growth, leading to the eradication of susceptible bacterial strains.Formula:C18H20FN5O4Purity:Min. 95%Molecular weight:389.38 g/mol



