CAS 17547-09-0
:BOC-BETA-ALA-ONP
Description:
BOC-BETA-ALA-ONP, also known as N-Boc-β-alanine-ONP, is a chemical compound characterized by its structure, which includes a tert-butyloxycarbonyl (Boc) protecting group attached to the amino acid β-alanine, along with a p-nitrophenyl (ONP) moiety. This compound is typically used in peptide synthesis and as a building block in organic chemistry due to its ability to protect the amino group during reactions. The Boc group is a common protecting group that can be easily removed under mild acidic conditions, allowing for selective deprotection when needed. The presence of the p-nitrophenyl group can also facilitate further reactions, such as coupling with other amino acids or compounds. BOC-BETA-ALA-ONP is generally stable under standard laboratory conditions but should be handled with care, following appropriate safety protocols. Its applications extend to research in biochemistry and medicinal chemistry, particularly in the development of peptide-based therapeutics.
Formula:C14H18N2O6
InChI:InChI=1/C14H18N2O6/c1-14(2,3)22-13(18)15-9-8-12(17)21-11-6-4-10(5-7-11)16(19)20/h4-7H,8-9H2,1-3H3,(H,15,18)
SMILES:CC(C)(C)OC(=NCCC(=O)Oc1ccc(cc1)N(=O)=O)O
Synonyms:- Boc-Beta-Alanine 4-Nitrophenyl Ester
- Boc-b-Ala-ONp
- Boc-β-alanine 4-nitrophenyl ester
- 4-nitrophenyl N-(tert-butoxycarbonyl)-beta-alaninate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
