CymitQuimica logo

CAS 175471-65-5

:

2-Amino-1-(2-O-methyl-β-D-ribofuranosyl)-4(1H)-pyrimidinone

Description:
2-Amino-1-(2-O-methyl-β-D-ribofuranosyl)-4(1H)-pyrimidinone is a nucleoside analog characterized by its pyrimidine base structure and a ribofuranosyl sugar moiety. This compound features an amino group at the 2-position of the pyrimidine ring and a methoxy group at the 2' position of the ribose, which enhances its solubility and stability. The presence of the ribofuranosyl sugar is crucial for its biological activity, as it mimics natural nucleosides, potentially allowing it to interfere with nucleic acid synthesis. This compound may exhibit antiviral or anticancer properties, making it of interest in pharmaceutical research. Its molecular structure contributes to its ability to interact with various biological targets, and its specific stereochemistry can influence its biological efficacy. As with many nucleoside analogs, the compound's pharmacokinetics, including absorption, distribution, metabolism, and excretion, are essential for determining its therapeutic potential. Overall, 2-Amino-1-(2-O-methyl-β-D-ribofuranosyl)-4(1H)-pyrimidinone represents a significant area of study in medicinal chemistry and drug development.
Formula:C10H15N3O5
InChI:InChI=1S/C10H15N3O5/c1-17-8-7(16)5(4-14)18-9(8)13-3-2-6(15)12-10(13)11/h2-3,5,7-9,14,16H,4H2,1H3,(H2,11,12,15)/t5-,7-,8-,9-/m1/s1
InChI key:InChIKey=YNICOGPIWXQHOX-ZOQUXTDFSA-N
SMILES:O(C)[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(N)=NC(=O)C=C2
Synonyms:
  • 2-Amino-1-(2-O-methyl-β-D-ribofuranosyl)-4(1H)-pyrimidinone
  • 4(1H)-Pyrimidinone, 2-amino-1-(2-O-methyl-β-D-ribofuranosyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.