CAS 175476-52-5
:4-sulfamoylbutyric acid
Description:
4-Sulfamoylbutyric acid is an organic compound characterized by the presence of a sulfonamide functional group and a carboxylic acid group. It features a butyric acid backbone, which consists of a four-carbon chain, with a sulfonamide group (-SO2NH2) attached to the fourth carbon. This compound is typically a white to off-white solid and is soluble in polar solvents due to its ionic and polar functional groups. The sulfonamide moiety contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both the sulfonamide and carboxylic acid groups allows for various interactions, such as hydrogen bonding, which can influence its reactivity and solubility. Additionally, 4-sulfamoylbutyric acid may exhibit properties such as antibacterial or anti-inflammatory effects, although specific biological activities would depend on further research and context. As with many sulfonamides, it is important to consider safety and handling protocols due to potential toxicity or allergic reactions associated with sulfonamide compounds.
Formula:C4H8NO4S
InChI:InChI=1/C4H9NO4S/c5-10(8,9)3-1-2-4(6)7/h1-3H2,(H,6,7)(H2,5,8,9)/p-1
SMILES:C(CC(=O)[O-])CS(=O)(=O)N
Synonyms:- 3-Carboxypropanesulfonamide
- 3-Carboxypropanesolfonamide
- 4-Sulfamoylbutanoic Acid
- 4-Sulfamoylbutanoate
- 4-Sulfamoyl-Butanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Butanoic acid, 4-(aminosulfonyl)-
CAS:Formula:C4H9NO4SPurity:95%Color and Shape:SolidMolecular weight:167.18364-Sulphamoylbutanoic acid
CAS:<p>4-Sulphamoylbutanoic acid</p>Formula:C4H9NO4SPurity:98%Color and Shape: off-white powderMolecular weight:167.18356g/mol4-Sulfamoylbutyric Acid
CAS:Controlled Product<p>Applications A solid phase organic linker for synthesis of tethering carboxylic acids to support.<br>References Backes, B.J. and Ellman, J. A.: J. Org. Chem., 64, 2322 (1999)<br></p>Formula:C4H9NO4SColor and Shape:NeatMolecular weight:167.183-Carboxypropanesulfonamide
CAS:<p>3-Carboxypropanesulfonamide is a chemical compound that has been shown to have the ability to modulate cardiac cell function. This compound has been shown to be effective in a reaction monitoring technique, which monitors the functional groups and techniques of chemical reactions, in order to introduce this molecule into the cell membrane and alter its potential. 3-Carboxypropanesulfonamide is capable of changing the lipid composition of the membrane by introducing a linker group that can bind with other molecules such as cholesterol or phospholipids. This linker group alters the membrane potential of cells, leading to changes in ion flow and cellular response.</p>Formula:C4H9NO4SPurity:Min. 95%Color and Shape:White PowderMolecular weight:167.18 g/mol





