CAS 175533-32-1
:5-Quinolinecarboxamide
Description:
5-Quinolinecarboxamide, identified by its CAS number 175533-32-1, is a chemical compound that features a quinoline ring structure, which is a bicyclic aromatic compound consisting of a benzene ring fused to a pyridine ring. This compound typically exhibits characteristics such as being a solid at room temperature and possessing moderate solubility in organic solvents. Its molecular structure includes an amide functional group, which contributes to its potential biological activity and interactions. 5-Quinolinecarboxamide may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in the context of antimicrobial or anticancer agents. The presence of the quinoline moiety often correlates with various pharmacological properties, making it a subject of research in various fields, including biochemistry and pharmacology. Additionally, the compound's stability and reactivity can be influenced by the specific substituents on the quinoline ring, which can affect its overall chemical behavior and potential applications.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c11-10(13)8-3-1-5-9-7(8)4-2-6-12-9/h1-6H,(H2,11,13)
InChI key:InChIKey=LZHJFZLHEGJWAU-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C2=C(C=CC1)N=CC=C2
Synonyms:- 5-Quinolinecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Quinoline-5-carboxamide
CAS:<p>Quinoline-5-carboxamide is an amide that has a mass spectrometric peak at m/z of 238. It is also a polymorphic compound, with three different crystalline forms that can be obtained by modifying the reaction conditions. The nitro group in the molecule helps to stabilize the molecule and can be used as a preparative method for separating it from other compounds. Quinoline-5-carboxamide has been shown to have interactions with hydrogen and other molecules. This interaction is due to the heterocyclic nature of the compound and its carbonyl group. Quinoline-5-carboxamide is also able to form intramolecular hydrogen bonds with itself and other molecules, which may explain why it interacts with hydrogen so easily.</p>Formula:C10H8N2OPurity:Min. 95%Molecular weight:172.18 g/mol
